C34H35N5O3 — CID 155058705
N-methyl-9-[(1S,3R,4S)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-6-phenylmethoxypurin-2-amine (PubChem CID 155058705) has the molecular formula C34H35N5O3 and a molecular weight of 561.69 g/mol. Its IUPAC name is N-methyl-9-[(1S,3R,4S)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-6-phenylmethoxypurin-2-amine.
| Compound Name | N-methyl-9-[(1S,3R,4S)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-6-phenylmethoxypurin-2-amine |
|---|---|
| PubChem CID | 155058705 |
| Molecular Formula | C34H35N5O3 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | N-methyl-9-[(1S,3R,4S)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-6-phenylmethoxypurin-2-amine |
| SMILES | C=C1[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)C[C@@H]1n1cnc2c(OCc3ccccc3)nc(NC)nc21 |
| InChI | InChI=1S/C34H35N5O3/c1-24-28(22-40-19-25-12-6-3-7-13-25)30(41-20-26-14-8-4-9-15-26)18-29(24)39-23-36-31-32(39)37-34(35-2)38-33(31)42-21-27-16-10-5-11-17-27/h3-17,23,28-30H,1,18-22H2,2H3,(H,35,37,38)/t28-,29-,30-/m0/s1 |
| InChIKey | JOUGOULWWIGMJX-DTXPUJKBSA-N |
| XLogP | 6.37 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|