C18H18IN5O5 — CID 10673300
N-[9-[(2R,4S,5S)-4,5-dihydroxyoxolan-2-yl]-6-[(4-iodophenyl)methoxy]purin-2-yl]acetamide (PubChem CID 10673300) has the molecular formula C18H18IN5O5 and a molecular weight of 511.28 g/mol. Its IUPAC name is N-[9-[(2R,4S,5S)-4,5-dihydroxyoxolan-2-yl]-6-[(4-iodophenyl)methoxy]purin-2-yl]acetamide.
| Compound Name | N-[9-[(2R,4S,5S)-4,5-dihydroxyoxolan-2-yl]-6-[(4-iodophenyl)methoxy]purin-2-yl]acetamide |
|---|---|
| PubChem CID | 10673300 |
| Molecular Formula | C18H18IN5O5 |
| Molecular Weight | 511.28 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | N-[9-[(2R,4S,5S)-4,5-dihydroxyoxolan-2-yl]-6-[(4-iodophenyl)methoxy]purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(OCc2ccc(I)cc2)c2ncn([C@H]3C[C@H](O)[C@@H](O)O3)c2n1 |
| InChI | InChI=1S/C18H18IN5O5/c1-9(25)21-18-22-15-14(20-8-24(15)13-6-12(26)17(27)29-13)16(23-18)28-7-10-2-4-11(19)5-3-10/h2-5,8,12-13,17,26-27H,6-7H2,1H3,(H,21,22,23,25)/t12-,13+,17-/m0/s1 |
| InChIKey | FWTVYWIGZWTGNT-AHIWAGSCSA-N |
| XLogP | 1.57 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|