C19H22N9O5P3 — CID 58214277
5-[[2-amino-9-[4-hydroxy-5-[(2-phosphorosodiphosphanyl)methyl]oxolan-2-yl]purin-6-yl]oxymethyl]-2-azido-N-methylbenzamide (PubChem CID 58214277) has the molecular formula C19H22N9O5P3 and a molecular weight of 549.37 g/mol. Its IUPAC name is 5-[[2-amino-9-[4-hydroxy-5-[(2-phosphorosodiphosphanyl)methyl]oxolan-2-yl]purin-6-yl]oxymethyl]-2-azido-N-methylbenzamide.
| Compound Name | 5-[[2-amino-9-[4-hydroxy-5-[(2-phosphorosodiphosphanyl)methyl]oxolan-2-yl]purin-6-yl]oxymethyl]-2-azido-N-methylbenzamide |
|---|---|
| PubChem CID | 58214277 |
| Molecular Formula | C19H22N9O5P3 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 5-[[2-amino-9-[4-hydroxy-5-[(2-phosphorosodiphosphanyl)methyl]oxolan-2-yl]purin-6-yl]oxymethyl]-2-azido-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(COc2nc(N)nc3c2ncn3C2CC(O)C(CPPP=O)O2)ccc1N=[N+]=[N-] |
| InChI | InChI=1S/C19H22N9O5P3/c1-22-17(30)10-4-9(2-3-11(10)26-27-21)6-32-18-15-16(24-19(20)25-18)28(8-23-15)14-5-12(29)13(33-14)7-34-36-35-31/h2-4,8,12-14,29,34,36H,5-7H2,1H3,(H,22,30)(H2,20,24,25) |
| InChIKey | KBUINWHZORFUCF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 203.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|