C33H45N8O7P3 — CID 123923091
[4-[[2-amino-9-[4-hydroxy-5-[(2-phosphorosodiphosphanyl)methyl]oxolan-2-yl]purin-6-yl]oxymethyl]phenyl] 2-(azidomethyl)-4-butoxybenzoate;ethane (PubChem CID 123923091) has the molecular formula C33H45N8O7P3 and a molecular weight of 758.69 g/mol. Its IUPAC name is [4-[[2-amino-9-[4-hydroxy-5-[(2-phosphorosodiphosphanyl)methyl]oxolan-2-yl]purin-6-yl]oxymethyl]phenyl] 2-(azidomethyl)-4-butoxybenzoate;ethane.
| Compound Name | [4-[[2-amino-9-[4-hydroxy-5-[(2-phosphorosodiphosphanyl)methyl]oxolan-2-yl]purin-6-yl]oxymethyl]phenyl] 2-(azidomethyl)-4-butoxybenzoate;ethane |
|---|---|
| PubChem CID | 123923091 |
| Molecular Formula | C33H45N8O7P3 |
| Molecular Weight | 758.69 g/mol |
| Exact Mass | 758.26 |
| IUPAC Name | [4-[[2-amino-9-[4-hydroxy-5-[(2-phosphorosodiphosphanyl)methyl]oxolan-2-yl]purin-6-yl]oxymethyl]phenyl] 2-(azidomethyl)-4-butoxybenzoate;ethane |
| SMILES | CC.CC.CCCCOc1ccc(C(=O)Oc2ccc(COc3nc(N)nc4c3ncn4C3CC(O)C(CPPP=O)O3)cc2)c(CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C29H33N8O7P3.2C2H6/c1-2-3-10-41-20-8-9-21(18(11-20)13-33-36-31)28(39)43-19-6-4-17(5-7-19)14-42-27-25-26(34-29(30)35-27)37(16-32-25)24-12-22(38)23(44-24)15-45-47-46-40;2*1-2/h4-9,11,16,22-24,38,45,47H,2-3,10,12-15H2,1H3,(H2,30,34,35);2*1-2H3 |
| InChIKey | ISJRDKKVRKYYLC-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 209.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.69 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|