C18H18N8O4 — CID 101090046
2-(azidomethyl)-N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 101090046) has the molecular formula C18H18N8O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is 2-(azidomethyl)-N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | 2-(azidomethyl)-N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 101090046 |
| Molecular Formula | C18H18N8O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-(azidomethyl)-N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | [N-]=[N+]=NCc1ccccc1C(=O)Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C18H18N8O4/c19-25-23-6-10-3-1-2-4-11(10)18(29)24-16-15-17(21-8-20-16)26(9-22-15)14-5-12(28)13(7-27)30-14/h1-4,8-9,12-14,27-28H,5-7H2,(H,20,21,24,29)/t12-,13+,14+/m0/s1 |
| InChIKey | UEBDCGGMXPBMRB-BFHYXJOUSA-N |
| XLogP | 1.53 |
| TPSA | 171.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|