C18H11F8N5O5 — CID 118606041
2,2,2-trifluoro-N-[9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,3,4,5,6-pentafluorophenoxy)purin-2-yl]acetamide (PubChem CID 118606041) has the molecular formula C18H11F8N5O5 and a molecular weight of 529.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,3,4,5,6-pentafluorophenoxy)purin-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,3,4,5,6-pentafluorophenoxy)purin-2-yl]acetamide |
|---|---|
| PubChem CID | 118606041 |
| Molecular Formula | C18H11F8N5O5 |
| Molecular Weight | 529.30 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,3,4,5,6-pentafluorophenoxy)purin-2-yl]acetamide |
| SMILES | O=C(Nc1nc(Oc2c(F)c(F)c(F)c(F)c2F)c2ncn([C@H]3C[C@@H](O)[C@@H](CO)O3)c2n1)C(F)(F)F |
| InChI | InChI=1S/C18H11F8N5O5/c19-7-8(20)10(22)13(11(23)9(7)21)36-15-12-14(28-17(29-15)30-16(34)18(24,25)26)31(3-27-12)6-1-4(33)5(2-32)35-6/h3-6,32-33H,1-2H2,(H,28,29,30,34)/t4-,5-,6-/m1/s1 |
| InChIKey | KFIKWWRRRTUWEZ-HSUXUTPPSA-N |
| XLogP | 2.46 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|