C22H26N6O7 — CID 131885644
N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-yl]-2-methylpropanamide (PubChem CID 131885644) has the molecular formula C22H26N6O7 and a molecular weight of 486.49 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 131885644 |
| Molecular Formula | C22H26N6O7 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nc(OCCc2ccc([N+](=O)[O-])cc2)c2ncn([C@H]3C[C@H](O)[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C22H26N6O7/c1-12(2)20(31)25-22-24-19-18(23-11-27(19)17-9-15(30)16(10-29)35-17)21(26-22)34-8-7-13-3-5-14(6-4-13)28(32)33/h3-6,11-12,15-17,29-30H,7-10H2,1-2H3,(H,24,25,26,31)/t15-,16+,17+/m0/s1 |
| InChIKey | LJCIZKLYRPZBHU-GVDBMIGSSA-N |
| XLogP | 1.59 |
| TPSA | 174.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|