C19H20FN5O6 — CID 59080300
(2R,3R,5R)-5-[[2-fluoro-6-[2-(4-nitrophenyl)ethoxy]purin-9-yl]methyl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 59080300) has the molecular formula C19H20FN5O6 and a molecular weight of 433.40 g/mol. Its IUPAC name is (2R,3R,5R)-5-[[2-fluoro-6-[2-(4-nitrophenyl)ethoxy]purin-9-yl]methyl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-[[2-fluoro-6-[2-(4-nitrophenyl)ethoxy]purin-9-yl]methyl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 59080300 |
| Molecular Formula | C19H20FN5O6 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (2R,3R,5R)-5-[[2-fluoro-6-[2-(4-nitrophenyl)ethoxy]purin-9-yl]methyl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | O=[N+]([O-])c1ccc(CCOc2nc(F)nc3c2ncn3C[C@H]2C[C@@H](O)[C@@H](CO)O2)cc1 |
| InChI | InChI=1S/C19H20FN5O6/c20-19-22-17-16(21-10-24(17)8-13-7-14(27)15(9-26)31-13)18(23-19)30-6-5-11-1-3-12(4-2-11)25(28)29/h1-4,10,13-15,26-27H,5-9H2/t13-,14-,15-/m1/s1 |
| InChIKey | QMKCZDFKQZSOQS-RBSFLKMASA-N |
| XLogP | 1.01 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|