C26H29IrN7O10 — CID 153365640
2-[2,6-bis[2-(4-nitrophenyl)ethoxy]purin-9-yl]-N-(2-hydroxyethyl)acetamide;hydroperoxymethane;iridium (PubChem CID 153365640) has the molecular formula C26H29IrN7O10 and a molecular weight of 791.77 g/mol. Its IUPAC name is 2-[2,6-bis[2-(4-nitrophenyl)ethoxy]purin-9-yl]-N-(2-hydroxyethyl)acetamide;hydroperoxymethane;iridium.
| Compound Name | 2-[2,6-bis[2-(4-nitrophenyl)ethoxy]purin-9-yl]-N-(2-hydroxyethyl)acetamide;hydroperoxymethane;iridium |
|---|---|
| PubChem CID | 153365640 |
| Molecular Formula | C26H29IrN7O10 |
| Molecular Weight | 791.77 g/mol |
| Exact Mass | 792.16 |
| IUPAC Name | 2-[2,6-bis[2-(4-nitrophenyl)ethoxy]purin-9-yl]-N-(2-hydroxyethyl)acetamide;hydroperoxymethane;iridium |
| SMILES | COO.O=C(Cn1cnc2c(OCCc3ccc([N+](=O)[O-])cc3)nc(OCCc3ccc([N+](=O)[O-])cc3)nc21)NCCO.[Ir] |
| InChI | InChI=1S/C25H25N7O8.CH4O2.Ir/c33-12-11-26-21(34)15-30-16-27-22-23(30)28-25(40-14-10-18-3-7-20(8-4-18)32(37)38)29-24(22)39-13-9-17-1-5-19(6-2-17)31(35)36;1-3-2;/h1-8,16,33H,9-15H2,(H,26,34);2H,1H3; |
| InChIKey | BFQXHTPXJZIKQE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 227.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.77 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|