C26H28N6O6 — CID 160602471
9-[(2R)-2-methylbutyl]-2,6-bis[2-(4-nitrophenyl)ethoxy]purine (PubChem CID 160602471) has the molecular formula C26H28N6O6 and a molecular weight of 520.55 g/mol. Its IUPAC name is 9-[(2R)-2-methylbutyl]-2,6-bis[2-(4-nitrophenyl)ethoxy]purine.
| Compound Name | 9-[(2R)-2-methylbutyl]-2,6-bis[2-(4-nitrophenyl)ethoxy]purine |
|---|---|
| PubChem CID | 160602471 |
| Molecular Formula | C26H28N6O6 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 9-[(2R)-2-methylbutyl]-2,6-bis[2-(4-nitrophenyl)ethoxy]purine |
| SMILES | CC[C@@H](C)Cn1cnc2c(OCCc3ccc([N+](=O)[O-])cc3)nc(OCCc3ccc([N+](=O)[O-])cc3)nc21 |
| InChI | InChI=1S/C26H28N6O6/c1-3-18(2)16-30-17-27-23-24(30)28-26(38-15-13-20-6-10-22(11-7-20)32(35)36)29-25(23)37-14-12-19-4-8-21(9-5-19)31(33)34/h4-11,17-18H,3,12-16H2,1-2H3/t18-/m1/s1 |
| InChIKey | YVAUGLDVMGQTMA-GOSISDBHSA-N |
| XLogP | 4.93 |
| TPSA | 148.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|