C21H21FN6O6 — CID 142523221
(2R,3R,4R,5S)-4-fluoro-2-(hydroxymethyl)-5-[[4-[2-(4-nitrophenyl)ethoxy]imidazo[2,1-b]purin-1-yl]methyl]oxolan-3-ol (PubChem CID 142523221) has the molecular formula C21H21FN6O6 and a molecular weight of 472.43 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-fluoro-2-(hydroxymethyl)-5-[[4-[2-(4-nitrophenyl)ethoxy]imidazo[2,1-b]purin-1-yl]methyl]oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-4-fluoro-2-(hydroxymethyl)-5-[[4-[2-(4-nitrophenyl)ethoxy]imidazo[2,1-b]purin-1-yl]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 142523221 |
| Molecular Formula | C21H21FN6O6 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (2R,3R,4R,5S)-4-fluoro-2-(hydroxymethyl)-5-[[4-[2-(4-nitrophenyl)ethoxy]imidazo[2,1-b]purin-1-yl]methyl]oxolan-3-ol |
| SMILES | O=[N+]([O-])c1ccc(CCOc2nc3nccn3c3c2ncn3C[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2F)cc1 |
| InChI | InChI=1S/C21H21FN6O6/c22-16-14(34-15(10-29)18(16)30)9-26-11-24-17-19(25-21-23-6-7-27(21)20(17)26)33-8-5-12-1-3-13(4-2-12)28(31)32/h1-4,6-7,11,14-16,18,29-30H,5,8-10H2/t14-,15+,16-,18+/m0/s1 |
| InChIKey | QATOGRGBYOWBOM-UIBIWLFHSA-N |
| XLogP | 1.07 |
| TPSA | 150.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|