C14H12FN5O3 — CID 58818821
2-fluoro-9-methyl-6-[2-(4-nitrophenyl)ethoxy]purine (PubChem CID 58818821) has the molecular formula C14H12FN5O3 and a molecular weight of 317.28 g/mol. Its IUPAC name is 2-fluoro-9-methyl-6-[2-(4-nitrophenyl)ethoxy]purine.
| Compound Name | 2-fluoro-9-methyl-6-[2-(4-nitrophenyl)ethoxy]purine |
|---|---|
| PubChem CID | 58818821 |
| Molecular Formula | C14H12FN5O3 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-fluoro-9-methyl-6-[2-(4-nitrophenyl)ethoxy]purine |
| SMILES | Cn1cnc2c(OCCc3ccc([N+](=O)[O-])cc3)nc(F)nc21 |
| InChI | InChI=1S/C14H12FN5O3/c1-19-8-16-11-12(19)17-14(15)18-13(11)23-7-6-9-2-4-10(5-3-9)20(21)22/h2-5,8H,6-7H2,1H3 |
| InChIKey | VHABPEVGLQIWEY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|