C22H26N6O6 — CID 159247213
[(2R,3R,4R,5R)-2-[2-amino-6-[2-(4-nitrophenyl)ethoxy]purin-9-yl]-5-ethyl-4-methyloxolan-3-yl] acetate (PubChem CID 159247213) has the molecular formula C22H26N6O6 and a molecular weight of 470.49 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[2-amino-6-[2-(4-nitrophenyl)ethoxy]purin-9-yl]-5-ethyl-4-methyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2-[2-amino-6-[2-(4-nitrophenyl)ethoxy]purin-9-yl]-5-ethyl-4-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 159247213 |
| Molecular Formula | C22H26N6O6 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[2-amino-6-[2-(4-nitrophenyl)ethoxy]purin-9-yl]-5-ethyl-4-methyloxolan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(OCCc4ccc([N+](=O)[O-])cc4)nc(N)nc32)[C@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C22H26N6O6/c1-4-16-12(2)18(33-13(3)29)21(34-16)27-11-24-17-19(27)25-22(23)26-20(17)32-10-9-14-5-7-15(8-6-14)28(30)31/h5-8,11-12,16,18,21H,4,9-10H2,1-3H3,(H2,23,25,26)/t12-,16-,18-,21-/m1/s1 |
| InChIKey | KUVGVZOMOOEYCV-BZVIESNCSA-N |
| XLogP | 2.81 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|