C56H47FN6O6 — CID 10440825
9-[(2R,3S,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-amine (PubChem CID 10440825) has the molecular formula C56H47FN6O6 and a molecular weight of 919.03 g/mol. Its IUPAC name is 9-[(2R,3S,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-amine.
| Compound Name | 9-[(2R,3S,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-amine |
|---|---|
| PubChem CID | 10440825 |
| Molecular Formula | C56H47FN6O6 |
| Molecular Weight | 919.03 g/mol |
| Exact Mass | 918.35 |
| IUPAC Name | 9-[(2R,3S,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-6-[2-(4-nitrophenyl)ethoxy]purin-2-amine |
| SMILES | Nc1nc(OCCc2ccc([N+](=O)[O-])cc2)c2ncn([C@@H]3O[C@H](COC(c4ccccc4)(c4ccccc4)c4ccccc4)[C@@H](OC(c4ccccc4)(c4ccccc4)c4ccccc4)[C@@H]3F)c2n1 |
| InChI | InChI=1S/C56H47FN6O6/c57-48-50(69-56(43-25-13-4-14-26-43,44-27-15-5-16-28-44)45-29-17-6-18-30-45)47(37-67-55(40-19-7-1-8-20-40,41-21-9-2-10-22-41)42-23-11-3-12-24-42)68-53(48)62-38-59-49-51(62)60-54(58)61-52(49)66-36-35-39-31-33-46(34-32-39)63(64)65/h1-34,38,47-48,50,53H,35-37H2,(H2,58,60,61)/t47-,48+,50-,53-/m1/s1 |
| InChIKey | DKURXOBVKDMVAA-IQGPXEKXSA-N |
| XLogP | 10.56 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.03 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|