C52H46N6O11P- — CID 23257300
[(2R,3R,4R,5R)-4-benzoyloxy-2-[6-(benzylamino)purin-9-yl]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] 2-(4-nitrophenyl)ethyl phosphate (PubChem CID 23257300) has the molecular formula C52H46N6O11P- and a molecular weight of 961.95 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-benzoyloxy-2-[6-(benzylamino)purin-9-yl]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] 2-(4-nitrophenyl)ethyl phosphate.
| Compound Name | [(2R,3R,4R,5R)-4-benzoyloxy-2-[6-(benzylamino)purin-9-yl]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] 2-(4-nitrophenyl)ethyl phosphate |
|---|---|
| PubChem CID | 23257300 |
| Molecular Formula | C52H46N6O11P- |
| Molecular Weight | 961.95 g/mol |
| Exact Mass | 961.30 |
| IUPAC Name | [(2R,3R,4R,5R)-4-benzoyloxy-2-[6-(benzylamino)purin-9-yl]-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl] 2-(4-nitrophenyl)ethyl phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NCc5ccccc5)ncnc43)[C@H](OP(=O)([O-])OCCc3ccc([N+](=O)[O-])cc3)[C@@H]2OC(=O)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C52H47N6O11P/c1-64-43-28-24-41(25-29-43)52(39-18-10-4-11-19-39,40-20-12-5-13-21-40)65-33-44-46(68-51(59)38-16-8-3-9-17-38)47(69-70(62,63)66-31-30-36-22-26-42(27-23-36)58(60)61)50(67-44)57-35-56-45-48(54-34-55-49(45)57)53-32-37-14-6-2-7-15-37/h2-29,34-35,44,46-47,50H,30-33H2,1H3,(H,62,63)(H,53,54,55)/p-1/t44-,46-,47-,50-/m1/s1 |
| InChIKey | LOXGKXKHDKRSBS-ULKCLTFGSA-M |
| XLogP | 8.60 |
| TPSA | 211.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.95 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|