C50H44FN5O3 — CID 67641094
9-[(2R,3R,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-N,N-dimethylpurin-6-amine (PubChem CID 67641094) has the molecular formula C50H44FN5O3 and a molecular weight of 781.93 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-N,N-dimethylpurin-6-amine.
| Compound Name | 9-[(2R,3R,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-N,N-dimethylpurin-6-amine |
|---|---|
| PubChem CID | 67641094 |
| Molecular Formula | C50H44FN5O3 |
| Molecular Weight | 781.93 g/mol |
| Exact Mass | 781.34 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-N,N-dimethylpurin-6-amine |
| SMILES | CN(C)c1ncnc2c1ncn2[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1F |
| InChI | InChI=1S/C50H44FN5O3/c1-55(2)46-44-47(53-34-52-46)56(35-54-44)48-43(51)45(59-50(39-27-15-6-16-28-39,40-29-17-7-18-30-40)41-31-19-8-20-32-41)42(58-48)33-57-49(36-21-9-3-10-22-36,37-23-11-4-12-24-37)38-25-13-5-14-26-38/h3-32,34-35,42-43,45,48H,33H2,1-2H3/t42-,43-,45-,48-/m1/s1 |
| InChIKey | JIKIUTNMDIGHGO-YAYCHGGOSA-N |
| XLogP | 9.51 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.93 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|