C46H53N5O7Si — CID 164586582
N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]-N-methylbenzamide (PubChem CID 164586582) has the molecular formula C46H53N5O7Si and a molecular weight of 816.04 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]-N-methylbenzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 164586582 |
| Molecular Formula | C46H53N5O7Si |
| Molecular Weight | 816.04 g/mol |
| Exact Mass | 815.37 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]-N-methylbenzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(N(C)C(=O)c5ccccc5)ncnc43)[C@H](OC)[C@@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C46H53N5O7Si/c1-45(2,3)59(8,9)58-39-37(28-56-46(32-18-14-11-15-19-32,33-20-24-35(53-5)25-21-33)34-22-26-36(54-6)27-23-34)57-44(40(39)55-7)51-30-49-38-41(47-29-48-42(38)51)50(4)43(52)31-16-12-10-13-17-31/h10-27,29-30,37,39-40,44H,28H2,1-9H3/t37-,39-,40-,44-/m1/s1 |
| InChIKey | QYCDWEXWRHYHCB-JXQBFNLHSA-N |
| XLogP | 8.43 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.04 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|