C49H49N5O6 — CID 54170183
N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]-N-[(4-tert-butylphenyl)methyl]benzamide (PubChem CID 54170183) has the molecular formula C49H49N5O6 and a molecular weight of 803.96 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]-N-[(4-tert-butylphenyl)methyl]benzamide.
| Compound Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]-N-[(4-tert-butylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 54170183 |
| Molecular Formula | C49H49N5O6 |
| Molecular Weight | 803.96 g/mol |
| Exact Mass | 803.37 |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]-N-[(4-tert-butylphenyl)methyl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(N(Cc5ccc(C(C)(C)C)cc5)C(=O)c5ccccc5)ncnc43)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C49H49N5O6/c1-48(2,3)35-18-16-33(17-19-35)29-53(47(56)34-12-8-6-9-13-34)45-44-46(51-31-50-45)54(32-52-44)43-28-41(55)42(60-43)30-59-49(36-14-10-7-11-15-36,37-20-24-39(57-4)25-21-37)38-22-26-40(58-5)27-23-38/h6-27,31-32,41-43,55H,28-30H2,1-5H3/t41-,42+,43+/m0/s1 |
| InChIKey | OULURTMECJLPJQ-VDXPIPGDSA-N |
| XLogP | 8.65 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.96 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|