C22H25Cl2N5O6P+ — CID 90738774
[5-[6-(2,5-dichlorophenoxy)-2-(2-methylpropanoylamino)purin-9-yl]-2-propyloxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 90738774) has the molecular formula C22H25Cl2N5O6P+ and a molecular weight of 557.35 g/mol. Its IUPAC name is [5-[6-(2,5-dichlorophenoxy)-2-(2-methylpropanoylamino)purin-9-yl]-2-propyloxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [5-[6-(2,5-dichlorophenoxy)-2-(2-methylpropanoylamino)purin-9-yl]-2-propyloxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90738774 |
| Molecular Formula | C22H25Cl2N5O6P+ |
| Molecular Weight | 557.35 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | [5-[6-(2,5-dichlorophenoxy)-2-(2-methylpropanoylamino)purin-9-yl]-2-propyloxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | CCCC1OC(n2cnc3c(Oc4cc(Cl)ccc4Cl)nc(NC(=O)C(C)C)nc32)CC1O[P+](=O)O |
| InChI | InChI=1S/C22H24Cl2N5O6P/c1-4-5-14-16(35-36(31)32)9-17(33-14)29-10-25-18-19(29)26-22(27-20(30)11(2)3)28-21(18)34-15-8-12(23)6-7-13(15)24/h6-8,10-11,14,16-17H,4-5,9H2,1-3H3,(H-,26,27,28,30,31,32)/p+1 |
| InChIKey | LPMBUBMWRWEMII-UHFFFAOYSA-O |
| XLogP | 5.64 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.35 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|