C17H14FN4O7P — CID 10626822
[(2R,3S,5R)-5-(6-benzoyloxy-2-fluoropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-oxido-oxophosphanium (PubChem CID 10626822) has the molecular formula C17H14FN4O7P and a molecular weight of 436.29 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-benzoyloxy-2-fluoropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-oxido-oxophosphanium.
| Compound Name | [(2R,3S,5R)-5-(6-benzoyloxy-2-fluoropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-oxido-oxophosphanium |
|---|---|
| PubChem CID | 10626822 |
| Molecular Formula | C17H14FN4O7P |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [(2R,3S,5R)-5-(6-benzoyloxy-2-fluoropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-oxido-oxophosphanium |
| SMILES | O=C(Oc1nc(F)nc2c1ncn2[C@H]1C[C@H](O[P+](=O)[O-])[C@@H](CO)O1)c1ccccc1 |
| InChI | InChI=1S/C17H14FN4O7P/c18-17-20-14-13(15(21-17)28-16(24)9-4-2-1-3-5-9)19-8-22(14)12-6-10(29-30(25)26)11(7-23)27-12/h1-5,8,10-12,23H,6-7H2/t10-,11+,12+/m0/s1 |
| InChIKey | HFGJNNHXTMAQLQ-QJPTWQEYSA-N |
| XLogP | 0.87 |
| TPSA | 148.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|