C17H18IN5O4 — CID 136916109
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(4-iodophenyl)methylamino]-1H-purin-6-one (PubChem CID 136916109) has the molecular formula C17H18IN5O4 and a molecular weight of 483.27 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(4-iodophenyl)methylamino]-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(4-iodophenyl)methylamino]-1H-purin-6-one |
|---|---|
| PubChem CID | 136916109 |
| Molecular Formula | C17H18IN5O4 |
| Molecular Weight | 483.27 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(4-iodophenyl)methylamino]-1H-purin-6-one |
| SMILES | O=c1[nH]c(NCc2ccc(I)cc2)nc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C17H18IN5O4/c18-10-3-1-9(2-4-10)6-19-17-21-15-14(16(26)22-17)20-8-23(15)13-5-11(25)12(7-24)27-13/h1-4,8,11-13,24-25H,5-7H2,(H2,19,21,22,26)/t11-,12+,13+/m0/s1 |
| InChIKey | RIGKXTDERZIWMC-YNEHKIRRSA-N |
| XLogP | 0.98 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|