C57H60N6O4Si — CID 170719592
N-[9-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]-6-[(4-methylphenyl)methoxy]purin-2-yl]-2-methylpropanamide (PubChem CID 170719592) has the molecular formula C57H60N6O4Si and a molecular weight of 921.23 g/mol. Its IUPAC name is N-[9-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]-6-[(4-methylphenyl)methoxy]purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]-6-[(4-methylphenyl)methoxy]purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 170719592 |
| Molecular Formula | C57H60N6O4Si |
| Molecular Weight | 921.23 g/mol |
| Exact Mass | 920.44 |
| IUPAC Name | N-[9-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]-6-[(4-methylphenyl)methoxy]purin-2-yl]-2-methylpropanamide |
| SMILES | Cc1ccc(COc2nc(NC(=O)C(C)C)nc3c2ncn3[C@H]2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C57H60N6O4Si/c1-41(2)53(64)60-55-59-52-51(54(61-55)65-38-43-34-32-42(3)33-35-43)58-40-63(52)50-37-62(57(44-22-12-7-13-23-44,45-24-14-8-15-25-45)46-26-16-9-17-27-46)36-47(67-50)39-66-68(56(4,5)6,48-28-18-10-19-29-48)49-30-20-11-21-31-49/h7-35,40-41,47,50H,36-39H2,1-6H3,(H,59,60,61,64)/t47-,50+/m0/s1 |
| InChIKey | HWIKMQQCCVWZOF-FZZKXCPISA-N |
| XLogP | 10.08 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.23 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|