C37H42N6O4S — CID 170719553
2-methyl-N-[6-[(2-methylpropan-2-yl)oxy]-9-[(2R)-6-(sulfanyloxymethyl)-4-tritylmorpholin-2-yl]purin-2-yl]propanamide (PubChem CID 170719553) has the molecular formula C37H42N6O4S and a molecular weight of 666.85 g/mol. Its IUPAC name is 2-methyl-N-[6-[(2-methylpropan-2-yl)oxy]-9-[(2R)-6-(sulfanyloxymethyl)-4-tritylmorpholin-2-yl]purin-2-yl]propanamide.
| Compound Name | 2-methyl-N-[6-[(2-methylpropan-2-yl)oxy]-9-[(2R)-6-(sulfanyloxymethyl)-4-tritylmorpholin-2-yl]purin-2-yl]propanamide |
|---|---|
| PubChem CID | 170719553 |
| Molecular Formula | C37H42N6O4S |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | 2-methyl-N-[6-[(2-methylpropan-2-yl)oxy]-9-[(2R)-6-(sulfanyloxymethyl)-4-tritylmorpholin-2-yl]purin-2-yl]propanamide |
| SMILES | CC(C)C(=O)Nc1nc(OC(C)(C)C)c2ncn([C@H]3CN(C(c4ccccc4)(c4ccccc4)c4ccccc4)CC(COS)O3)c2n1 |
| InChI | InChI=1S/C37H42N6O4S/c1-25(2)33(44)40-35-39-32-31(34(41-35)47-36(3,4)5)38-24-43(32)30-22-42(21-29(46-30)23-45-48)37(26-15-9-6-10-16-26,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,24-25,29-30,48H,21-23H2,1-5H3,(H,39,40,41,44)/t29?,30-/m1/s1 |
| InChIKey | CWHPYKWNUGPWNI-BDCODIICSA-N |
| XLogP | 6.65 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|