C33H35ClN7O3P — CID 166591212
N-[9-[(2R,6S)-6-[[chloro(dimethylamino)phosphanyl]oxymethyl]-4-tritylmorpholin-2-yl]purin-6-yl]acetamide (PubChem CID 166591212) has the molecular formula C33H35ClN7O3P and a molecular weight of 644.12 g/mol. Its IUPAC name is N-[9-[(2R,6S)-6-[[chloro(dimethylamino)phosphanyl]oxymethyl]-4-tritylmorpholin-2-yl]purin-6-yl]acetamide.
| Compound Name | N-[9-[(2R,6S)-6-[[chloro(dimethylamino)phosphanyl]oxymethyl]-4-tritylmorpholin-2-yl]purin-6-yl]acetamide |
|---|---|
| PubChem CID | 166591212 |
| Molecular Formula | C33H35ClN7O3P |
| Molecular Weight | 644.12 g/mol |
| Exact Mass | 643.22 |
| IUPAC Name | N-[9-[(2R,6S)-6-[[chloro(dimethylamino)phosphanyl]oxymethyl]-4-tritylmorpholin-2-yl]purin-6-yl]acetamide |
| SMILES | CC(=O)Nc1ncnc2c1ncn2[C@H]1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@@H](COP(Cl)N(C)C)O1 |
| InChI | InChI=1S/C33H35ClN7O3P/c1-24(42)38-31-30-32(36-22-35-31)41(23-37-30)29-20-40(19-28(44-29)21-43-45(34)39(2)3)33(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-18,22-23,28-29H,19-21H2,1-3H3,(H,35,36,38,42)/t28-,29+,45?/m0/s1 |
| InChIKey | AUTXAXARGLXLJM-UXUJHHPPSA-N |
| XLogP | 6.02 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.12 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|