C36H40ClF3N5O5P — CID 129029096
N-[3-[[chloro-[[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]phosphanyl]-methylamino]propyl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 129029096) has the molecular formula C36H40ClF3N5O5P and a molecular weight of 746.17 g/mol. Its IUPAC name is N-[3-[[chloro-[[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]phosphanyl]-methylamino]propyl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[3-[[chloro-[[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]phosphanyl]-methylamino]propyl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 129029096 |
| Molecular Formula | C36H40ClF3N5O5P |
| Molecular Weight | 746.17 g/mol |
| Exact Mass | 745.24 |
| IUPAC Name | N-[3-[[chloro-[[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]phosphanyl]-methylamino]propyl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | Cc1cn(C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC(COP(Cl)N(C)CCCN(C)C(=O)C(F)(F)F)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C36H40ClF3N5O5P/c1-26-22-45(34(48)41-32(26)46)31-24-44(23-30(50-31)25-49-51(37)43(3)21-13-20-42(2)33(47)36(38,39)40)35(27-14-7-4-8-15-27,28-16-9-5-10-17-28)29-18-11-6-12-19-29/h4-12,14-19,22,30-31H,13,20-21,23-25H2,1-3H3,(H,41,46,48) |
| InChIKey | HSVXOUZWUDYJNW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.17 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|