C32H37ClN5O5P — CID 129029785
1-[(2R,6S)-6-[[[2-aminoethyl(methyl)amino]-chlorophosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 129029785) has the molecular formula C32H37ClN5O5P and a molecular weight of 638.11 g/mol. Its IUPAC name is 1-[(2R,6S)-6-[[[2-aminoethyl(methyl)amino]-chlorophosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,6S)-6-[[[2-aminoethyl(methyl)amino]-chlorophosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129029785 |
| Molecular Formula | C32H37ClN5O5P |
| Molecular Weight | 638.11 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | 1-[(2R,6S)-6-[[[2-aminoethyl(methyl)amino]-chlorophosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@@H](COP(=O)(Cl)N(C)CCN)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C32H37ClN5O5P/c1-24-20-38(31(40)35-30(24)39)29-22-37(21-28(43-29)23-42-44(33,41)36(2)19-18-34)32(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17,20,28-29H,18-19,21-23,34H2,1-2H3,(H,35,39,40)/t28-,29+,44?/m0/s1 |
| InChIKey | UVJXZDLYCBGETK-NTEHWFDVSA-N |
| XLogP | 4.29 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.11 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|