C38H45ClFN6O5P — CID 145269832
1-[6-[[chloro-[4-(1-fluoropiperidin-4-yl)piperazin-1-yl]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 145269832) has the molecular formula C38H45ClFN6O5P and a molecular weight of 751.24 g/mol. Its IUPAC name is 1-[6-[[chloro-[4-(1-fluoropiperidin-4-yl)piperazin-1-yl]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[6-[[chloro-[4-(1-fluoropiperidin-4-yl)piperazin-1-yl]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 145269832 |
| Molecular Formula | C38H45ClFN6O5P |
| Molecular Weight | 751.24 g/mol |
| Exact Mass | 750.29 |
| IUPAC Name | 1-[6-[[chloro-[4-(1-fluoropiperidin-4-yl)piperazin-1-yl]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC(COP(=O)(Cl)N3CCN(C4CCN(F)CC4)CC3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C38H45ClFN6O5P/c1-29-25-46(37(48)41-36(29)47)35-27-43(38(30-11-5-2-6-12-30,31-13-7-3-8-14-31)32-15-9-4-10-16-32)26-34(51-35)28-50-52(39,49)45-23-21-42(22-24-45)33-17-19-44(40)20-18-33/h2-16,25,33-35H,17-24,26-28H2,1H3,(H,41,47,48) |
| InChIKey | MRUSCZALOHGIFH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.24 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|