C36H43ClN5O5P — CID 126679137
1-[6-[[chloro-(4-propan-2-ylpiperazin-1-yl)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 126679137) has the molecular formula C36H43ClN5O5P and a molecular weight of 692.20 g/mol. Its IUPAC name is 1-[6-[[chloro-(4-propan-2-ylpiperazin-1-yl)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[6-[[chloro-(4-propan-2-ylpiperazin-1-yl)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126679137 |
| Molecular Formula | C36H43ClN5O5P |
| Molecular Weight | 692.20 g/mol |
| Exact Mass | 691.27 |
| IUPAC Name | 1-[6-[[chloro-(4-propan-2-ylpiperazin-1-yl)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC(COP(=O)(Cl)N3CCN(C(C)C)CC3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C36H43ClN5O5P/c1-27(2)39-19-21-41(22-20-39)48(37,45)46-26-32-24-40(25-33(47-32)42-23-28(3)34(43)38-35(42)44)36(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-18,23,27,32-33H,19-22,24-26H2,1-3H3,(H,38,43,44) |
| InChIKey | JYAPFNQLIDLTII-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.20 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|