C33H36ClN4O6P — CID 155074764
chloro-[2-[[(2S,6R)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methyl]morpholin-4-yl]phosphinic acid (PubChem CID 155074764) has the molecular formula C33H36ClN4O6P and a molecular weight of 651.10 g/mol. Its IUPAC name is chloro-[2-[[(2S,6R)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methyl]morpholin-4-yl]phosphinic acid.
| Compound Name | chloro-[2-[[(2S,6R)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methyl]morpholin-4-yl]phosphinic acid |
|---|---|
| PubChem CID | 155074764 |
| Molecular Formula | C33H36ClN4O6P |
| Molecular Weight | 651.10 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | chloro-[2-[[(2S,6R)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methyl]morpholin-4-yl]phosphinic acid |
| SMILES | Cc1cn([C@H]2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@H](CC3CN(P(=O)(O)Cl)CCO3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H36ClN4O6P/c1-24-20-38(32(40)35-31(24)39)30-23-36(21-29(44-30)19-28-22-37(17-18-43-28)45(34,41)42)33(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-16,20,28-30H,17-19,21-23H2,1H3,(H,41,42)(H,35,39,40)/t28?,29-,30+/m0/s1 |
| InChIKey | XSLZYFUWMLJYGA-YHCMTOLSSA-N |
| XLogP | 4.47 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.10 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|