C34H39ClN5O5P — CID 126677319
1-[(2R)-6-[[(4-aminopiperidin-1-yl)-chlorophosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 126677319) has the molecular formula C34H39ClN5O5P and a molecular weight of 664.14 g/mol. Its IUPAC name is 1-[(2R)-6-[[(4-aminopiperidin-1-yl)-chlorophosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R)-6-[[(4-aminopiperidin-1-yl)-chlorophosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126677319 |
| Molecular Formula | C34H39ClN5O5P |
| Molecular Weight | 664.14 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | 1-[(2R)-6-[[(4-aminopiperidin-1-yl)-chlorophosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC(COP(=O)(Cl)N3CCC(N)CC3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H39ClN5O5P/c1-25-21-40(33(42)37-32(25)41)31-23-38(22-30(45-31)24-44-46(35,43)39-19-17-29(36)18-20-39)34(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-16,21,29-31H,17-20,22-24,36H2,1H3,(H,37,41,42)/t30?,31-,46?/m1/s1 |
| InChIKey | ZCXNCMKFJRNJGF-GAFNMLMBSA-N |
| XLogP | 4.82 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.14 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|