C14H22ClN4O6P — CID 123489749
1-[6-[[chloro(morpholin-4-yl)phosphoryl]oxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 123489749) has the molecular formula C14H22ClN4O6P and a molecular weight of 408.78 g/mol. Its IUPAC name is 1-[6-[[chloro(morpholin-4-yl)phosphoryl]oxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[6-[[chloro(morpholin-4-yl)phosphoryl]oxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123489749 |
| Molecular Formula | C14H22ClN4O6P |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-[6-[[chloro(morpholin-4-yl)phosphoryl]oxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CNCC(COP(=O)(Cl)N3CCOCC3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H22ClN4O6P/c1-10-8-19(14(21)17-13(10)20)12-7-16-6-11(25-12)9-24-26(15,22)18-2-4-23-5-3-18/h8,11-12,16H,2-7,9H2,1H3,(H,17,20,21) |
| InChIKey | XGBLSWRYUSSPMY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|