C14H22N3O8P — CID 11223048
[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid (PubChem CID 11223048) has the molecular formula C14H22N3O8P and a molecular weight of 391.32 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid |
|---|---|
| PubChem CID | 11223048 |
| Molecular Formula | C14H22N3O8P |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)N3CCOCC3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H22N3O8P/c1-9-7-17(14(20)15-13(9)19)12-6-10(18)11(25-12)8-24-26(21,22)16-2-4-23-5-3-16/h7,10-12,18H,2-6,8H2,1H3,(H,21,22)(H,15,19,20)/t10-,11+,12+/m0/s1 |
| InChIKey | YOOZOHHAYMFKBV-QJPTWQEYSA-N |
| XLogP | -1.06 |
| TPSA | 143.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|