C23H42N3O9P — CID 121439955
[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate;oxolane;2,2,6,6-tetramethylpiperidine (PubChem CID 121439955) has the molecular formula C23H42N3O9P and a molecular weight of 535.58 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate;oxolane;2,2,6,6-tetramethylpiperidine.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate;oxolane;2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 121439955 |
| Molecular Formula | C23H42N3O9P |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate;oxolane;2,2,6,6-tetramethylpiperidine |
| SMILES | C1CCOC1.CC1(C)CCCC(C)(C)N1.Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O8P.C9H19N.C4H8O/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18;1-8(2)6-5-7-9(3,4)10-8;1-2-4-5-3-1/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18);10H,5-7H2,1-4H3;1-4H2/t6-,7+,8+;;/m0../s1 |
| InChIKey | PZJSPWYYTJXKMQ-ZJWYQBPBSA-N |
| XLogP | 1.72 |
| TPSA | 172.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|