C16H27N4O6P — CID 140884152
5-methyl-1-[(6S)-4-methyl-6-[[methyl(morpholin-4-yl)phosphoryl]oxymethyl]morpholin-2-yl]pyrimidine-2,4-dione (PubChem CID 140884152) has the molecular formula C16H27N4O6P and a molecular weight of 402.39 g/mol. Its IUPAC name is 5-methyl-1-[(6S)-4-methyl-6-[[methyl(morpholin-4-yl)phosphoryl]oxymethyl]morpholin-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(6S)-4-methyl-6-[[methyl(morpholin-4-yl)phosphoryl]oxymethyl]morpholin-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140884152 |
| Molecular Formula | C16H27N4O6P |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 5-methyl-1-[(6S)-4-methyl-6-[[methyl(morpholin-4-yl)phosphoryl]oxymethyl]morpholin-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CN(C)C[C@@H](CO[P@](C)(=O)N3CCOCC3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H27N4O6P/c1-12-8-20(16(22)17-15(12)21)14-10-18(2)9-13(26-14)11-25-27(3,23)19-4-6-24-7-5-19/h8,13-14H,4-7,9-11H2,1-3H3,(H,17,21,22)/t13-,14?,27-/m0/s1 |
| InChIKey | BOKJWEKYCRGCIR-SHJMMNSSSA-N |
| XLogP | -0.15 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|