C11H17N2O7PS — CID 121342707
1-[(2R)-6-[[hydroxy(methoxy)phosphinothioyl]oxymethyl]-1,4-dioxan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 121342707) has the molecular formula C11H17N2O7PS and a molecular weight of 352.31 g/mol. Its IUPAC name is 1-[(2R)-6-[[hydroxy(methoxy)phosphinothioyl]oxymethyl]-1,4-dioxan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R)-6-[[hydroxy(methoxy)phosphinothioyl]oxymethyl]-1,4-dioxan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121342707 |
| Molecular Formula | C11H17N2O7PS |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 1-[(2R)-6-[[hydroxy(methoxy)phosphinothioyl]oxymethyl]-1,4-dioxan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COP(O)(=S)OCC1COC[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C11H17N2O7PS/c1-7-3-13(11(15)12-10(7)14)9-6-18-4-8(20-9)5-19-21(16,22)17-2/h3,8-9H,4-6H2,1-2H3,(H,16,22)(H,12,14,15)/t8?,9-,21?/m1/s1 |
| InChIKey | SNRDRIRQIWRRHP-HGLPFBIVSA-N |
| XLogP | -0.36 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|