C30H32ClN4O5P — CID 140892939
1-[(6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]pyrimidine-2,4-dione (PubChem CID 140892939) has the molecular formula C30H32ClN4O5P and a molecular weight of 595.04 g/mol. Its IUPAC name is 1-[(6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140892939 |
| Molecular Formula | C30H32ClN4O5P |
| Molecular Weight | 595.04 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 1-[(6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]pyrimidine-2,4-dione |
| SMILES | CN(C)[P@](=O)(Cl)OC[C@@H]1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C30H32ClN4O5P/c1-33(2)41(31,38)39-22-26-20-34(21-28(40-26)35-19-18-27(36)32-29(35)37)30(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-19,26,28H,20-22H2,1-2H3,(H,32,36,37)/t26-,28?,41-/m0/s1 |
| InChIKey | GCLNBTZDWZLIOP-WEVAWCESSA-N |
| XLogP | 4.65 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.04 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|