C35H42ClN4O5P — CID 134331123
1-[6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-pentylpyrimidine-2,4-dione (PubChem CID 134331123) has the molecular formula C35H42ClN4O5P and a molecular weight of 665.17 g/mol. Its IUPAC name is 1-[6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-pentylpyrimidine-2,4-dione.
| Compound Name | 1-[6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-pentylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134331123 |
| Molecular Formula | C35H42ClN4O5P |
| Molecular Weight | 665.17 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | 1-[6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-pentylpyrimidine-2,4-dione |
| SMILES | CCCCCc1cn(C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC(COP(=O)(Cl)N(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C35H42ClN4O5P/c1-4-5-9-16-27-23-40(34(42)37-33(27)41)32-25-39(24-31(45-32)26-44-46(36,43)38(2)3)35(28-17-10-6-11-18-28,29-19-12-7-13-20-29)30-21-14-8-15-22-30/h6-8,10-15,17-23,31-32H,4-5,9,16,24-26H2,1-3H3,(H,37,41,42) |
| InChIKey | QRPWOWMDQUKINQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.17 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|