C37H45ClN3O5P — CID 142718199
1-[(2R,6S)-6-[[chloro-[hexyl(methyl)amino]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyridine-2,4-dione (PubChem CID 142718199) has the molecular formula C37H45ClN3O5P and a molecular weight of 678.21 g/mol. Its IUPAC name is 1-[(2R,6S)-6-[[chloro-[hexyl(methyl)amino]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyridine-2,4-dione.
| Compound Name | 1-[(2R,6S)-6-[[chloro-[hexyl(methyl)amino]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyridine-2,4-dione |
|---|---|
| PubChem CID | 142718199 |
| Molecular Formula | C37H45ClN3O5P |
| Molecular Weight | 678.21 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | 1-[(2R,6S)-6-[[chloro-[hexyl(methyl)amino]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-5-methylpyridine-2,4-dione |
| SMILES | CCCCCCN(C)P(=O)(Cl)OC[C@@H]1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](N2C=C(C)C(=O)CC2=O)O1 |
| InChI | InChI=1S/C37H45ClN3O5P/c1-4-5-6-16-23-39(3)47(38,44)45-28-33-26-40(27-36(46-33)41-25-29(2)34(42)24-35(41)43)37(30-17-10-7-11-18-30,31-19-12-8-13-20-31)32-21-14-9-15-22-32/h7-15,17-22,25,33,36H,4-6,16,23-24,26-28H2,1-3H3/t33-,36+,47?/m0/s1 |
| InChIKey | IAMQRFJPUQYXHD-CNQJSFQLSA-N |
| XLogP | 7.59 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.21 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|