C50H50N4O3Si — CID 71606853
4-amino-1-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]-5-phenylpyrimidin-2-one (PubChem CID 71606853) has the molecular formula C50H50N4O3Si and a molecular weight of 783.06 g/mol. Its IUPAC name is 4-amino-1-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]-5-phenylpyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]-5-phenylpyrimidin-2-one |
|---|---|
| PubChem CID | 71606853 |
| Molecular Formula | C50H50N4O3Si |
| Molecular Weight | 783.06 g/mol |
| Exact Mass | 782.37 |
| IUPAC Name | 4-amino-1-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]-5-phenylpyrimidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](n2cc(-c3ccccc3)c(N)nc2=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H50N4O3Si/c1-49(2,3)58(43-30-18-8-19-31-43,44-32-20-9-21-33-44)56-37-42-34-53(36-46(57-42)54-35-45(47(51)52-48(54)55)38-22-10-4-11-23-38)50(39-24-12-5-13-25-39,40-26-14-6-15-27-40)41-28-16-7-17-29-41/h4-33,35,42,46H,34,36-37H2,1-3H3,(H2,51,52,55)/t42-,46+/m0/s1 |
| InChIKey | FWLFLLCMGLRJEC-JKOLSROFSA-N |
| XLogP | 8.26 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.06 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|