C48H48N6O3Si — CID 71604836
3-[6-amino-9-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]purin-8-yl]prop-2-yn-1-ol (PubChem CID 71604836) has the molecular formula C48H48N6O3Si and a molecular weight of 785.04 g/mol. Its IUPAC name is 3-[6-amino-9-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]purin-8-yl]prop-2-yn-1-ol.
| Compound Name | 3-[6-amino-9-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]purin-8-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 71604836 |
| Molecular Formula | C48H48N6O3Si |
| Molecular Weight | 785.04 g/mol |
| Exact Mass | 784.36 |
| IUPAC Name | 3-[6-amino-9-[(2R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tritylmorpholin-2-yl]purin-8-yl]prop-2-yn-1-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](n2c(C#CCO)nc3c(N)ncnc32)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H48N6O3Si/c1-47(2,3)58(40-26-15-7-16-27-40,41-28-17-8-18-29-41)56-34-39-32-53(33-43(57-39)54-42(30-19-31-55)52-44-45(49)50-35-51-46(44)54)48(36-20-9-4-10-21-36,37-22-11-5-12-23-37)38-24-13-6-14-25-38/h4-18,20-29,35,39,43,55H,31-34H2,1-3H3,(H2,49,50,51)/t39-,43+/m0/s1 |
| InChIKey | AHQSTLRHKVNMCG-ADZFYQLHSA-N |
| XLogP | 6.52 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.04 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|