C30H37N5O3Si — CID 101357912
methyl 2-[(1R,2S,4S)-4-(6-aminopurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]acetate (PubChem CID 101357912) has the molecular formula C30H37N5O3Si and a molecular weight of 543.74 g/mol. Its IUPAC name is methyl 2-[(1R,2S,4S)-4-(6-aminopurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2S,4S)-4-(6-aminopurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 101357912 |
| Molecular Formula | C30H37N5O3Si |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | methyl 2-[(1R,2S,4S)-4-(6-aminopurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@H](n2cnc3c(N)ncnc32)C[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H37N5O3Si/c1-30(2,3)39(24-11-7-5-8-12-24,25-13-9-6-10-14-25)38-18-22-16-23(15-21(22)17-26(36)37-4)35-20-34-27-28(31)32-19-33-29(27)35/h5-14,19-23H,15-18H2,1-4H3,(H2,31,32,33)/t21-,22-,23+/m1/s1 |
| InChIKey | XWPPTLKBGSJLFH-ZLNRFVROSA-N |
| XLogP | 4.12 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|