C44H53N5O2Si2 — CID 18657707
9-[(1R,2R,3S)-2,3-bis[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]purin-6-amine (PubChem CID 18657707) has the molecular formula C44H53N5O2Si2 and a molecular weight of 740.11 g/mol. Its IUPAC name is 9-[(1R,2R,3S)-2,3-bis[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]purin-6-amine.
| Compound Name | 9-[(1R,2R,3S)-2,3-bis[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]purin-6-amine |
|---|---|
| PubChem CID | 18657707 |
| Molecular Formula | C44H53N5O2Si2 |
| Molecular Weight | 740.11 g/mol |
| Exact Mass | 739.37 |
| IUPAC Name | 9-[(1R,2R,3S)-2,3-bis[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]purin-6-amine |
| SMILES | CC(C)(C)[Si](OC[C@H]1CC[C@@H](n2cnc3c(N)ncnc32)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H53N5O2Si2/c1-43(2,3)52(34-19-11-7-12-20-34,35-21-13-8-14-22-35)50-29-33-27-28-39(49-32-48-40-41(45)46-31-47-42(40)49)38(33)30-51-53(44(4,5)6,36-23-15-9-16-24-36)37-25-17-10-18-26-37/h7-26,31-33,38-39H,27-30H2,1-6H3,(H2,45,46,47)/t33-,38-,39-/m1/s1 |
| InChIKey | UXZBOAZHMAQYSR-SWBVYJIISA-N |
| XLogP | 7.13 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.11 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|