C29H27N5O2 — CID 155660909
[(2S,6R)-6-purin-9-yl-4-tritylmorpholin-2-yl]methanol (PubChem CID 155660909) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is [(2S,6R)-6-purin-9-yl-4-tritylmorpholin-2-yl]methanol.
| Compound Name | [(2S,6R)-6-purin-9-yl-4-tritylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 155660909 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | [(2S,6R)-6-purin-9-yl-4-tritylmorpholin-2-yl]methanol |
| SMILES | OC[C@@H]1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](n2cnc3cncnc32)O1 |
| InChI | InChI=1S/C29H27N5O2/c35-19-25-17-33(18-27(36-25)34-21-32-26-16-30-20-31-28(26)34)29(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-16,20-21,25,27,35H,17-19H2/t25-,27+/m0/s1 |
| InChIKey | RGECTWZZXDBKQG-AHKZPQOWSA-N |
| XLogP | 4.01 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|