C31H30N6O3 — CID 166591210
N-[9-[(2R,6S)-6-(hydroxymethyl)-4-tritylmorpholin-2-yl]purin-6-yl]acetamide (PubChem CID 166591210) has the molecular formula C31H30N6O3 and a molecular weight of 534.62 g/mol. Its IUPAC name is N-[9-[(2R,6S)-6-(hydroxymethyl)-4-tritylmorpholin-2-yl]purin-6-yl]acetamide.
| Compound Name | N-[9-[(2R,6S)-6-(hydroxymethyl)-4-tritylmorpholin-2-yl]purin-6-yl]acetamide |
|---|---|
| PubChem CID | 166591210 |
| Molecular Formula | C31H30N6O3 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | N-[9-[(2R,6S)-6-(hydroxymethyl)-4-tritylmorpholin-2-yl]purin-6-yl]acetamide |
| SMILES | CC(=O)Nc1ncnc2c1ncn2[C@H]1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@@H](CO)O1 |
| InChI | InChI=1S/C31H30N6O3/c1-22(39)35-29-28-30(33-20-32-29)37(21-34-28)27-18-36(17-26(19-38)40-27)31(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-16,20-21,26-27,38H,17-19H2,1H3,(H,32,33,35,39)/t26-,27+/m0/s1 |
| InChIKey | URLFNHWSISCXNB-RRPNLBNLSA-N |
| XLogP | 3.97 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|