C35H41N2O10P — CID 150719108
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxo-5-pentylpyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 150719108) has the molecular formula C35H41N2O10P and a molecular weight of 680.69 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxo-5-pentylpyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxo-5-pentylpyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 150719108 |
| Molecular Formula | C35H41N2O10P |
| Molecular Weight | 680.69 g/mol |
| Exact Mass | 680.25 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxo-5-pentylpyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | CCCCCc1cn([C@H]2C[C@H](OP(=O)(O)O)[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C35H41N2O10P/c1-4-5-7-10-24-22-37(34(39)36-33(24)38)32-21-30(47-48(40,41)42)31(46-32)23-45-35(25-11-8-6-9-12-25,26-13-17-28(43-2)18-14-26)27-15-19-29(44-3)20-16-27/h6,8-9,11-20,22,30-32H,4-5,7,10,21,23H2,1-3H3,(H,36,38,39)(H2,40,41,42)/t30-,31+,32+/m0/s1 |
| InChIKey | JPMIIHCPFLFLHV-DCMFLLSESA-N |
| XLogP | 5.06 |
| TPSA | 158.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|