C19H25ClN5O5P — CID 135295878
N-[1-[(6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-methylmorpholin-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 135295878) has the molecular formula C19H25ClN5O5P and a molecular weight of 469.87 g/mol. Its IUPAC name is N-[1-[(6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-methylmorpholin-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-methylmorpholin-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 135295878 |
| Molecular Formula | C19H25ClN5O5P |
| Molecular Weight | 469.87 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-[1-[(6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-methylmorpholin-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CN1CC(n2ccc(NC(=O)c3ccccc3)nc2=O)O[C@H](CO[P@](=O)(Cl)N(C)C)C1 |
| InChI | InChI=1S/C19H25ClN5O5P/c1-23(2)31(20,28)29-13-15-11-24(3)12-17(30-15)25-10-9-16(22-19(25)27)21-18(26)14-7-5-4-6-8-14/h4-10,15,17H,11-13H2,1-3H3,(H,21,22,26,27)/t15-,17?,31+/m0/s1 |
| InChIKey | ADEKYJORZQTFGQ-XRGNHSAWSA-N |
| XLogP | 2.25 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.87 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|