C35H33N4O6P — CID 166099176
[(2S,6R)-6-(4-benzamido-2-oxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methylphosphonic acid (PubChem CID 166099176) has the molecular formula C35H33N4O6P and a molecular weight of 636.65 g/mol. Its IUPAC name is [(2S,6R)-6-(4-benzamido-2-oxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methylphosphonic acid.
| Compound Name | [(2S,6R)-6-(4-benzamido-2-oxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 166099176 |
| Molecular Formula | C35H33N4O6P |
| Molecular Weight | 636.65 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | [(2S,6R)-6-(4-benzamido-2-oxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methylphosphonic acid |
| SMILES | O=C(Nc1ccn([C@H]2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@@H](CP(=O)(O)O)O2)c(=O)n1)c1ccccc1 |
| InChI | InChI=1S/C35H33N4O6P/c40-33(26-13-5-1-6-14-26)36-31-21-22-39(34(41)37-31)32-24-38(23-30(45-32)25-46(42,43)44)35(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-22,30,32H,23-25H2,(H2,42,43,44)(H,36,37,40,41)/t30-,32+/m0/s1 |
| InChIKey | WMCPAWXSUQTAOK-XDFJSJKPSA-N |
| XLogP | 4.86 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|