C37H35N3O5 — CID 66629024
N-[1-[(2R,4R,5R)-4-[bis(2-methylphenyl)-phenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 66629024) has the molecular formula C37H35N3O5 and a molecular weight of 601.70 g/mol. Its IUPAC name is N-[1-[(2R,4R,5R)-4-[bis(2-methylphenyl)-phenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,4R,5R)-4-[bis(2-methylphenyl)-phenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 66629024 |
| Molecular Formula | C37H35N3O5 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | N-[1-[(2R,4R,5R)-4-[bis(2-methylphenyl)-phenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | Cc1ccccc1C(c1ccccc1)(c1ccccc1C)[C@]1(O)C[C@H](n2ccc(NC(=O)c3ccccc3)nc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C37H35N3O5/c1-25-13-9-11-19-29(25)37(28-17-7-4-8-18-28,30-20-12-10-14-26(30)2)36(44)23-33(45-31(36)24-41)40-22-21-32(39-35(40)43)38-34(42)27-15-5-3-6-16-27/h3-22,31,33,41,44H,23-24H2,1-2H3,(H,38,39,42,43)/t31-,33-,36+/m1/s1 |
| InChIKey | PNKHHHNOZNBKHO-VZDRTSEESA-N |
| XLogP | 5.16 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|