C41H41N3O10 — CID 166786364
[2-[[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]-2-oxoethyl] 3,4,5-trimethoxybenzoate (PubChem CID 166786364) has the molecular formula C41H41N3O10 and a molecular weight of 735.79 g/mol. Its IUPAC name is [2-[[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]-2-oxoethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]-2-oxoethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 166786364 |
| Molecular Formula | C41H41N3O10 |
| Molecular Weight | 735.79 g/mol |
| Exact Mass | 735.28 |
| IUPAC Name | [2-[[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]-2-oxoethyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)OCC2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC(n3cc(C)c(=O)[nH]c3=O)O2)cc(OC)c1OC |
| InChI | InChI=1S/C41H41N3O10/c1-27-22-44(40(48)42-38(27)46)35-24-43(41(29-14-8-5-9-15-29,30-16-10-6-11-17-30)31-18-12-7-13-19-31)23-32(54-35)25-52-36(45)26-53-39(47)28-20-33(49-2)37(51-4)34(21-28)50-3/h5-22,32,35H,23-26H2,1-4H3,(H,42,46,48) |
| InChIKey | CLBDONQBBGPOKQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|