C41H42N2O9 — CID 10842484
3-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propyl benzoate (PubChem CID 10842484) has the molecular formula C41H42N2O9 and a molecular weight of 706.79 g/mol. Its IUPAC name is 3-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propyl benzoate.
| Compound Name | 3-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propyl benzoate |
|---|---|
| PubChem CID | 10842484 |
| Molecular Formula | C41H42N2O9 |
| Molecular Weight | 706.79 g/mol |
| Exact Mass | 706.29 |
| IUPAC Name | 3-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propyl benzoate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@]2(O)CCCOC(=O)c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H42N2O9/c1-28-26-43(39(46)42-37(28)44)36-25-40(47,23-10-24-50-38(45)29-11-6-4-7-12-29)35(52-36)27-51-41(30-13-8-5-9-14-30,31-15-19-33(48-2)20-16-31)32-17-21-34(49-3)22-18-32/h4-9,11-22,26,35-36,47H,10,23-25,27H2,1-3H3,(H,42,44,46)/t35-,36-,40+/m1/s1 |
| InChIKey | YYHCTIRXEGWTHZ-BNLRHUMVSA-N |
| XLogP | 5.53 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.79 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|